Drugs Information:
Fexofenadine
Basic Information
|
|
||
| ID | DDInter732 | |
| Drug Type | small molecule | |
| Molecular Formula | C32H39NO4 | |
| Molecular Weight | 501.656 | |
| CAS Number | 83799-24-0 | |
| Description | Fexofenadine is an over-the-counter second-generation antihistamine used in the treatment of various allergic symptoms.[L4269] It is selective for the H1 receptor, carries little-to-no activity at off-targets, and does not cross the blood-brain barrier[L10779] - this is in contrast to previous first-generation antihistamines, such as [diphenhydramine], which readily bind to off-targets that contribute to side effects such as sedation.[A1452] Fexofenadine is the major active metabolite of [terfenadine][A1495] and is administered as a racemic mixture in which both enantiomers display approximately equivalent antihistamine activity.[L10779] | |
| ATC Classification | R06AX26 | |
| IUPAC Name | 2-(4-{1-hydroxy-4-[4-(hydroxydiphenylmethyl)piperidin-1-yl]butyl}phenyl)-2-methylpropanoic acid | |
| InChI | RWTNPBWLLIMQHL-UHFFFAOYSA-N | |
| Canonical SMILES | CC(C)(C(O)=O)C1=CC=C(C=C1)C(O)CCCN1CCC(CC1)C(O)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| Useful Links | DrugBank ChEBI PubChem Substance KEGG Compound KEGG Drug ChemSpider BindingDB PharmGKB Therapeutic Targets Database Wikipedia ChEMBL | |
Interactions with
Fexofenadine
Filter:
| Severity level | ID | Name | Mechanism | Detail |
|---|
Interactions with diseases
Filter:
| Severity level | Disease name | Text | References |
|---|
Interactions with foods
Filter:
| Severity level | Food name | Description | Management | Mechanism | References |
|---|
Interactions with compound preparation
| Multi-DRUG trade | Multi-DRUG | Drug type | Warning | Note |
|---|