Drugs Information:
Dextrothyroxine
Basic Information
|
|
||
| ID | DDInter530 | |
| Drug Type | small molecule | |
| Molecular Formula | C15H11I4NO4 | |
| Molecular Weight | 776.870 | |
| CAS Number | 51-49-0 | |
| Description | The major hormone derived from the thyroid gland. Thyroxine is synthesized via the iodination of tyrosines (monoiodotyrosine) and the coupling of iodotyrosines (diiodotyrosine) in the thyroglobulin. Thyroxine is released from thyroglobulin by proteolysis and secreted into the blood. Thyroxine is peripherally deiodinated to form triiodothyronine which exerts a broad spectrum of stimulatory effects on cell metabolism. | |
| ATC Classification | C10AX01 | |
| IUPAC Name | (2R)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid | |
| InChI | XUIIKFGFIJCVMT-GFCCVEGCSA-N | |
| Canonical SMILES | N[C@H](CC1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)C(O)=O | |
| Useful Links | DrugBank ChEBI PubChem Substance ChemSpider BindingDB PharmGKB Wikipedia ChEMBL ZINC | |
Interactions with
Dextrothyroxine
Filter:
| Severity level | ID | Name | Mechanism | Detail |
|---|
Interactions with diseases
Filter:
| Severity level | Disease name | Text | References |
|---|
Interactions with foods
Filter:
| Severity level | Food name | Description | Management | Mechanism | References |
|---|
Interactions with compound preparation
| Multi-DRUG trade | Multi-DRUG | Drug type | Warning | Note |
|---|