Drugs Information:
Cyclobenzaprine
Basic Information
|
|
||
| ID | DDInter454 | |
| Drug Type | small molecule | |
| Molecular Formula | C20H21N | |
| Molecular Weight | 275.387 | |
| CAS Number | 303-53-7 | |
| Description | Cyclobenzaprine, a centrally-acting muscle relaxant, was first synthesized in 1961[A185039] and has been available for human use since 1977.[A184982] It was initially studied for use as antidepressant given its structural similarity to tricyclic antidepressants - it differs from [Amitriptyline] by only a single double bond.[A185039,A184982] Since its approval, it has remained relatively popular as an adjunctive, short-term treatment for acute skeletal muscle spasms secondary to musculoskeletal injury. | |
| ATC Classification | M03BX08 | |
| IUPAC Name | dimethyl(3-{tricyclo[9.4.0.0^{3,8}]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-ylidene}propyl)amine | |
| InChI | JURKNVYFZMSNLP-UHFFFAOYSA-N | |
| Canonical SMILES | CN(C)CCC=C1C2=CC=CC=C2C=CC2=CC=CC=C12 | |
| Useful Links | DrugBank ChEBI PubChem Substance KEGG Compound KEGG Drug ChemSpider BindingDB PharmGKB Therapeutic Targets Database Wikipedia ChEMBL ZINC | |
Interactions with
Cyclobenzaprine
Filter:
| Severity level | ID | Name | Mechanism | Detail |
|---|
Interactions with diseases
Filter:
| Severity level | Disease name | Text | References |
|---|
Interactions with foods
Filter:
| Severity level | Food name | Description | Management | Mechanism | References |
|---|
Interactions with compound preparation
| Multi-DRUG trade | Multi-DRUG | Drug type | Warning | Note |
|---|