Drugs Information:
Uracil mustard
Basic Information
|
|
||
| ID | DDInter1902 | |
| Drug Type | small molecule | |
| Molecular Formula | C8H11Cl2N3O2 | |
| Molecular Weight | 252.098 | |
| CAS Number | 66-75-1 | |
| Description | Nitrogen mustard derivative of uracil. It is a alkylating antineoplastic agent that is used in lymphatic malignancies, and causes mainly gastrointestinal and bone marrow damage. | |
| ATC Classification | L01AD08 | |
| IUPAC Name | 5-[bis(2-chloroethyl)amino]-1,2,3,4-tetrahydropyrimidine-2,4-dione | |
| InChI | IDPUKCWIGUEADI-UHFFFAOYSA-N | |
| Canonical SMILES | ClCCN(CCCl)C1=CNC(=O)NC1=O | |
| Useful Links | DrugBank ChEBI PubChem Substance KEGG Compound KEGG Drug ChemSpider PharmGKB Therapeutic Targets Database Wikipedia ChEMBL ZINC | |
Interactions with
Uracil mustard
Filter:
| Severity level | ID | Name | Mechanism | Detail |
|---|
Interactions with diseases
Filter:
| Severity level | Disease name | Text | References |
|---|
Interactions with foods
Filter:
| Severity level | Food name | Description | Management | Mechanism | References |
|---|
Interactions with compound preparation
| Multi-DRUG trade | Multi-DRUG | Drug type | Warning | Note |
|---|