Drugs Information:
Primaquine
Basic Information
|
|
||
| ID | DDInter1520 | |
| Drug Type | small molecule | |
| Molecular Formula | C15H21N3O | |
| Molecular Weight | 259.347 | |
| CAS Number | 90-34-6 | |
| Description | An aminoquinoline that is given by mouth to produce a radical cure and prevent relapse of vivax and ovale malarias following treatment with a blood schizontocide. It has also been used to prevent transmission of falciparum malaria by those returning to areas where there is a potential for re-introduction of malaria. Adverse effects include anemias and GI disturbances. (From Martindale, The Extra Pharmacopeia, 30th ed, p404) | |
| ATC Classification | P01BA03 | |
| IUPAC Name | N4-(6-methoxyquinolin-8-yl)pentane-1,4-diamine | |
| InChI | INDBQLZJXZLFIT-UHFFFAOYSA-N | |
| Canonical SMILES | COC1=CC(NC(C)CCCN)=C2N=CC=CC2=C1 | |
| Useful Links | DrugBank ChEBI PubChem Substance KEGG Compound ChemSpider BindingDB PharmGKB Therapeutic Targets Database Wikipedia ChEMBL | |
Interactions with
Primaquine
Filter:
| Severity level | ID | Name | Mechanism | Detail |
|---|
Interactions with diseases
Filter:
| Severity level | Disease name | Text | References |
|---|
Interactions with foods
Filter:
| Severity level | Food name | Description | Management | Mechanism | References |
|---|
Interactions with compound preparation
| Multi-DRUG trade | Multi-DRUG | Drug type | Warning | Note |
|---|