Drugs Information:
Potassium gluconate
Basic Information
|
|
||
| ID | DDInter1499 | |
| Drug Type | small molecule | |
| Molecular Formula | C6H11KO7 | |
| Molecular Weight | 234.245 | |
| CAS Number | 299-27-4 | |
| Description | Potassium gluconate is a salt of [DB01345] and is classified as a food additive by the FDA [L2654]. It is also used as a potassium supplement [L2657]. Potassium is an essential nutrient. It is the most abundant cation in the intracellular fluid, where it plays a key role in maintaining cell function [A32222]. In dietary supplements, potassium is often present as potassium chloride, but many other forms—including potassium citrate, phosphate, aspartate, bicarbonate, and **gluconate**—are also used [L2652]. Potassium gluconate is believed to be more palatable and non-acidifying than potassium chloride (KCl) [L2658]. | |
| ATC Classification | A12BA05 | |
| IUPAC Name | potassium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate | |
| InChI | HLCFGWHYROZGBI-JJKGCWMISA-M | |
| Canonical SMILES | [K+].[H][C@@](O)(CO)[C@@]([H])(O)[C@]([H])(O)[C@@]([H])(O)C([O-])=O | |
| Useful Links | DrugBank ChEBI PubChem Substance KEGG Drug ChemSpider Wikipedia ChEMBL | |
Interactions with
Potassium gluconate
Filter:
| Severity level | ID | Name | Mechanism | Detail |
|---|
Interactions with diseases
Filter:
| Severity level | Disease name | Text | References |
|---|
Interactions with foods
Filter:
| Severity level | Food name | Description | Management | Mechanism | References |
|---|
Interactions with compound preparation
| Multi-DRUG trade | Multi-DRUG | Drug type | Warning | Note |
|---|