Drugs Information:
Polymyxin B
Basic Information
|
|
||
| ID | DDInter1489 | |
| Drug Type | small molecule | |
| Molecular Formula | C56H98N16O13 | |
| Molecular Weight | 1203.499 | |
| CAS Number | 1404-26-8 | |
| Description | Polymyxin B was discovered in the 1940s[A176429]. They are basic polypeptides of about eight amino acids and have cationic detergent action on cell membranes[A176426]. Polymyxin B is used for infections with gram-negative organisms, but may be neurotoxic and nephrotoxic[A176426,FDA Label]. All gram-positive bacteria, fungi, and the gram-negative cocci, are resistant[A176426]. It is appropriate for treatment of infections of the urinary tract, meninges, and blood stream, caused by susceptible strains of _Pseudomonas aeruginosa_[FDA Label]. Polymyxin B has a narrow therapeutic index and so its use is limited and unlikely to be used first line[A176429]. | |
| ATC Classification | S02AA11 S03AA03 J01XB02 A07AA05 S01AA18 | |
| IUPAC Name | N-[(1S)-3-amino-1-{[(1S,2R)-1-{[(1S)-3-amino-1-{[(3S,6S,9S,12S,15R,18R,21S)-6,9,18-tris(2-aminoethyl)-15-benzyl-3-[(1R)-1-hydroxyethyl]-12-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptaazacyclotricosan-21-yl]carbamoyl}propyl]carbamoyl}-2-hydroxypropyl]carbamoyl}propyl]-6-methyloctanamide | |
| InChI | WQVJHHACXVLGBL-BPJDFBQWSA-N | |
| Canonical SMILES | [H][C@]1(NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC2=CC=CC=C2)NC(=O)[C@@H](CCN)NC(=O)[C@H](CCNC1=O)NC(=O)[C@H](CCN)NC(=O)[C@@H](NC(=O)[C@H](CCN)NC(=O)CCCCC(C)CC)[C@@H](C)O)[C@@H](C)O | |
| Useful Links | DrugBank ChemSpider BindingDB Wikipedia ChEMBL | |
Interactions with
Polymyxin B
Filter:
| Severity level | ID | Name | Mechanism | Detail |
|---|
Interactions with diseases
Filter:
| Severity level | Disease name | Text | References |
|---|
Interactions with foods
Filter:
| Severity level | Food name | Description | Management | Mechanism | References |
|---|
Interactions with compound preparation
| Multi-DRUG trade | Multi-DRUG | Drug type | Warning | Note |
|---|