Drugs Information:
Phenazopyridine
Basic Information
|
|
||
| ID | DDInter1438 | |
| Drug Type | small molecule | |
| Molecular Formula | C11H11N5 | |
| Molecular Weight | 213.239 | |
| CAS Number | 94-78-0 | |
| Description | Phenazopyridine, also known as Pyridium, is a urinary tract analgesic used for the short-term management of urinary tract irritation and its associated unpleasant symptoms such as burning and pain during urination. In the USA, this drug was previously marked by Roche but has been discontinued by the FDA.[L7832] It is still used in various parts of the world. Ingestion of phenazopyridine is found to change the appearance of the urine by imparting an orange or red color, as it is considered an azo dye.[L7829] | |
| ATC Classification | G04BX06 | |
| IUPAC Name | 3-[(1E)-2-phenyldiazen-1-yl]pyridine-2,6-diamine | |
| InChI | QPFYXYFORQJZEC-FOCLMDBBSA-N | |
| Canonical SMILES | NC1=NC(N)=C(C=C1)\N=N\C1=CC=CC=C1 | |
| Useful Links | DrugBank ChEBI PubChem Substance KEGG Compound KEGG Drug ChemSpider BindingDB PharmGKB Wikipedia ChEMBL ZINC | |
Interactions with
Phenazopyridine
Filter:
| Severity level | ID | Name | Mechanism | Detail |
|---|
Interactions with diseases
Filter:
| Severity level | Disease name | Text | References |
|---|
Interactions with foods
Filter:
| Severity level | Food name | Description | Management | Mechanism | References |
|---|
Interactions with compound preparation
| Multi-DRUG trade | Multi-DRUG | Drug type | Warning | Note |
|---|