Drugs Information:
Pentosan polysulfate
Basic Information
|
|
||
| ID | DDInter1424 | |
| Drug Type | small molecule | |
| Molecular Formula | C10H18O21S4 | |
| Molecular Weight | 602.497 | |
| CAS Number | 37300-21-3 | |
| Description | Pentosan polysulfate is a sulfated pentosyl polysaccharide with heparin-like properties. | |
| ATC Classification | C05BA04 G04BX15 | |
| IUPAC Name | [(2S,3R,4S,5R)-5-hydroxy-2-{[(3R,4S,5R,6R)-6-hydroxy-4,5-bis(sulfooxy)oxan-3-yl]oxy}-4-(sulfooxy)oxan-3-yl]oxidanesulfonic acid | |
| InChI | FCCNSUIJIOOXEZ-SJYYZXOBSA-N | |
| Canonical SMILES | O[C@@H]1CO[C@@H](O[C@@H]2CO[C@@H](O)[C@H](OS(O)(=O)=O)[C@H]2OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]1OS(O)(=O)=O | |
| Useful Links | DrugBank PubChem Substance ChemSpider PharmGKB Therapeutic Targets Database Wikipedia ChEMBL ZINC | |
Interactions with
Pentosan polysulfate
Filter:
| Severity level | ID | Name | Mechanism | Detail |
|---|
Interactions with diseases
Filter:
| Severity level | Disease name | Text | References |
|---|
Interactions with foods
Filter:
| Severity level | Food name | Description | Management | Mechanism | References |
|---|
Interactions with compound preparation
| Multi-DRUG trade | Multi-DRUG | Drug type | Warning | Note |
|---|