Drugs Information:
Nalidixic acid
Basic Information
|
|
||
| ID | DDInter1259 | |
| Drug Type | small molecule | |
| Molecular Formula | C12H12N2O3 | |
| Molecular Weight | 232.235 | |
| CAS Number | 389-08-2 | |
| Description | Nalidixic acid is a synthetic 1,8-naphthyridine antimicrobial agent with a limited bacteriocidal spectrum. It is an inhibitor of the A subunit of bacterial DNA gyrase. | |
| ATC Classification | J01MB02 | |
| IUPAC Name | 1-ethyl-7-methyl-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid | |
| InChI | MHWLWQUZZRMNGJ-UHFFFAOYSA-N | |
| Canonical SMILES | CCN1C=C(C(O)=O)C(=O)C2=C1N=C(C)C=C2 | |
| Useful Links | DrugBank ChEBI PubChem Substance KEGG Compound KEGG Drug ChemSpider BindingDB PharmGKB Therapeutic Targets Database Wikipedia ChEMBL ZINC | |
Interactions with
Nalidixic acid
Filter:
| Severity level | ID | Name | Mechanism | Detail |
|---|
Interactions with diseases
Filter:
| Severity level | Disease name | Text | References |
|---|
Interactions with foods
Filter:
| Severity level | Food name | Description | Management | Mechanism | References |
|---|
Interactions with compound preparation
| Multi-DRUG trade | Multi-DRUG | Drug type | Warning | Note |
|---|