Drugs Information:
Ascorbic acid
Basic Information
|
|
||
| ID | DDInter124 | |
| Drug Type | small molecule | |
| Molecular Formula | C6H8O6 | |
| Molecular Weight | 176.124 | |
| CAS Number | 50-81-7 | |
| Description | A six carbon compound related to glucose. It is found naturally in citrus fruits and many vegetables. Ascorbic acid is an essential nutrient in human diets, and necessary to maintain connective tissue and bone. Its biologically active form, vitamin C, functions as a reducing agent and coenzyme in several metabolic pathways. Vitamin C is considered an antioxidant. | |
| ATC Classification | G01AD03 A11GA01 A11GB01 S01XA15 | |
| IUPAC Name | (5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2,5-dihydrofuran-2-one | |
| InChI | CIWBSHSKHKDKBQ-JLAZNSOCSA-N | |
| Canonical SMILES | [H][C@@]1(OC(=O)C(O)=C1O)[C@@H](O)CO | |
| Useful Links | DrugBank ChEBI PubChem Substance KEGG Compound KEGG Drug ChemSpider BindingDB PharmGKB Therapeutic Targets Database Wikipedia ChEMBL ZINC | |
Interactions with
Ascorbic acid
Filter:
| Severity level | ID | Name | Mechanism | Detail |
|---|
Interactions with diseases
Filter:
| Severity level | Disease name | Text | References |
|---|
Interactions with foods
Filter:
| Severity level | Food name | Description | Management | Mechanism | References |
|---|
Interactions with compound preparation
| Multi-DRUG trade | Multi-DRUG | Drug type | Warning | Note |
|---|